About 3-methyloct-1-ene;3-methylpyridine
3-methyloct-1-ene;3-methylpyridine (PubChem CID 142210059) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-methyloct-1-ene;3-methylpyridine.
Molecular Properties
| Compound Name | 3-methyloct-1-ene;3-methylpyridine |
| PubChem CID | 142210059 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3-methyloct-1-ene;3-methylpyridine |
| SMILES | C=CC(C)CCCCC.Cc1cccnc1 |
| InChI | InChI=1S/C9H18.C6H7N/c1-4-6-7-8-9(3)5-2;1-6-3-2-4-7-5-6/h5,9H,2,4,6-8H2,1,3H3;2-5H,1H3 |
| InChIKey | PMKOMFWQURGFIP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyloct-1-ene;3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyloct-1-ene;3-methylpyridine?
The IUPAC name of 3-methyloct-1-ene;3-methylpyridine (CID 142210059) is 3-methyloct-1-ene;3-methylpyridine.
What is the SMILES notation for 3-methyloct-1-ene;3-methylpyridine?
The canonical SMILES for 3-methyloct-1-ene;3-methylpyridine is C=CC(C)CCCCC.Cc1cccnc1.
What is the InChIKey of 3-methyloct-1-ene;3-methylpyridine?
The InChIKey is PMKOMFWQURGFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C6H7N/c1-4-6-7-8-9(3)5-2;1-6-3-2-4-7-5-6/h5,9H,2,4,6-8H2,1,3H3;2-5H,1H3.
What are the key properties of 3-methyloct-1-ene;3-methylpyridine?
3-methyloct-1-ene;3-methylpyridine has a molecular weight of 219.37 g/mol, XLogP of 4.78, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyloct-1-ene;3-methylpyridine is sourced from PubChem (CID 142210059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).