C22H17ClN4O2S2 — CID 142210221
1-(5-chlorothiophen-2-yl)sulfanyl-3-[4-(5-oxo-2,3-dihydro-1H-pyrrolo[3,4-c]isoquinolin-4-yl)phenyl]urea (PubChem CID 142210221) has the molecular formula C22H17ClN4O2S2 and a molecular weight of 468.99 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfanyl-3-[4-(5-oxo-2,3-dihydro-1H-pyrrolo[3,4-c]isoquinolin-4-yl)phenyl]urea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfanyl-3-[4-(5-oxo-2,3-dihydro-1H-pyrrolo[3,4-c]isoquinolin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 142210221 |
| Molecular Formula | C22H17ClN4O2S2 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfanyl-3-[4-(5-oxo-2,3-dihydro-1H-pyrrolo[3,4-c]isoquinolin-4-yl)phenyl]urea |
| SMILES | O=C(NSc1ccc(Cl)s1)Nc1ccc(-n2c3c(c4ccccc4c2=O)CNC3)cc1 |
| InChI | InChI=1S/C22H17ClN4O2S2/c23-19-9-10-20(30-19)31-26-22(29)25-13-5-7-14(8-6-13)27-18-12-24-11-17(18)15-3-1-2-4-16(15)21(27)28/h1-10,24H,11-12H2,(H2,25,26,29) |
| InChIKey | JFHRZYBWPDKSIL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|