C12H15N3O4S — CID 142210392
N-methyl-N-[(7-methyl-1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazin-6-yl)carbamoyl]formamide (PubChem CID 142210392) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-methyl-N-[(7-methyl-1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazin-6-yl)carbamoyl]formamide.
| Compound Name | N-methyl-N-[(7-methyl-1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazin-6-yl)carbamoyl]formamide |
|---|---|
| PubChem CID | 142210392 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-methyl-N-[(7-methyl-1,1-dioxo-3,4-dihydro-2H-1λ6,4-benzothiazin-6-yl)carbamoyl]formamide |
| SMILES | Cc1cc2c(cc1NC(=O)N(C)C=O)NCCS2(=O)=O |
| InChI | InChI=1S/C12H15N3O4S/c1-8-5-11-10(13-3-4-20(11,18)19)6-9(8)14-12(17)15(2)7-16/h5-7,13H,3-4H2,1-2H3,(H,14,17) |
| InChIKey | RQMDDFLZLRMIGD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|