C20H15Cl2FN4O3S2 — CID 142210786
1-[(E)-1-(1-chloroethenylsulfanyl)prop-1-enyl]sulfanyl-3-[3-chloro-4-(6-fluoro-2,4-dioxo-1H-quinazolin-3-yl)phenyl]urea (PubChem CID 142210786) has the molecular formula C20H15Cl2FN4O3S2 and a molecular weight of 513.40 g/mol. Its IUPAC name is 1-[(E)-1-(1-chloroethenylsulfanyl)prop-1-enyl]sulfanyl-3-[3-chloro-4-(6-fluoro-2,4-dioxo-1H-quinazolin-3-yl)phenyl]urea.
| Compound Name | 1-[(E)-1-(1-chloroethenylsulfanyl)prop-1-enyl]sulfanyl-3-[3-chloro-4-(6-fluoro-2,4-dioxo-1H-quinazolin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 142210786 |
| Molecular Formula | C20H15Cl2FN4O3S2 |
| Molecular Weight | 513.40 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | 1-[(E)-1-(1-chloroethenylsulfanyl)prop-1-enyl]sulfanyl-3-[3-chloro-4-(6-fluoro-2,4-dioxo-1H-quinazolin-3-yl)phenyl]urea |
| SMILES | C=C(Cl)S/C(=C\C)SNC(=O)Nc1ccc(-n2c(=O)[nH]c3ccc(F)cc3c2=O)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl2FN4O3S2/c1-3-17(31-10(2)21)32-26-19(29)24-12-5-7-16(14(22)9-12)27-18(28)13-8-11(23)4-6-15(13)25-20(27)30/h3-9H,2H2,1H3,(H,25,30)(H2,24,26,29)/b17-3+ |
| InChIKey | BFJYNLBYNDPREV-IJUHEHPCSA-N |
| XLogP | 5.55 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|