C12H18F3N — CID 142211333
(3Z,6E)-N-ethyl-8,8,8-trifluoro-N,7-dimethylocta-1,3,6-trien-2-amine (PubChem CID 142211333) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is (3Z,6E)-N-ethyl-8,8,8-trifluoro-N,7-dimethylocta-1,3,6-trien-2-amine.
| Compound Name | (3Z,6E)-N-ethyl-8,8,8-trifluoro-N,7-dimethylocta-1,3,6-trien-2-amine |
|---|---|
| PubChem CID | 142211333 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3Z,6E)-N-ethyl-8,8,8-trifluoro-N,7-dimethylocta-1,3,6-trien-2-amine |
| SMILES | C=C(/C=C\C/C=C(\C)C(F)(F)F)N(C)CC |
| InChI | InChI=1S/C12H18F3N/c1-5-16(4)11(3)9-7-6-8-10(2)12(13,14)15/h7-9H,3,5-6H2,1-2,4H3/b9-7-,10-8+ |
| InChIKey | CUMBEZWJUDRIQF-FKJILZIQSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|