C23H30O — CID 142211796
4-methyl-1-[(2E,4Z)-6-(4-methylcyclohexyl)octa-2,4-dien-7-yn-3-yl]oxycyclohepta-1,3,5-triene (PubChem CID 142211796) has the molecular formula C23H30O and a molecular weight of 322.49 g/mol. Its IUPAC name is 4-methyl-1-[(2E,4Z)-6-(4-methylcyclohexyl)octa-2,4-dien-7-yn-3-yl]oxycyclohepta-1,3,5-triene.
| Compound Name | 4-methyl-1-[(2E,4Z)-6-(4-methylcyclohexyl)octa-2,4-dien-7-yn-3-yl]oxycyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142211796 |
| Molecular Formula | C23H30O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 4-methyl-1-[(2E,4Z)-6-(4-methylcyclohexyl)octa-2,4-dien-7-yn-3-yl]oxycyclohepta-1,3,5-triene |
| SMILES | C#CC(/C=C\C(=C/C)OC1=CC=C(C)C=CC1)C1CCC(C)CC1 |
| InChI | InChI=1S/C23H30O/c1-5-20(21-13-10-19(4)11-14-21)15-17-22(6-2)24-23-9-7-8-18(3)12-16-23/h1,6-8,12,15-17,19-21H,9-11,13-14H2,2-4H3/b17-15-,22-6+ |
| InChIKey | LYRLOCYTTKTBHF-XREGFPRMSA-N |
| XLogP | 6.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|