C29H46O7S2 — CID 142212016
(3Z,5Z)-5-methylhepta-1,3,5-triene;8-oxo-2-phenylpentadecane-2,14-disulfonic acid (PubChem CID 142212016) has the molecular formula C29H46O7S2 and a molecular weight of 570.81 g/mol. Its IUPAC name is (3Z,5Z)-5-methylhepta-1,3,5-triene;8-oxo-2-phenylpentadecane-2,14-disulfonic acid.
| Compound Name | (3Z,5Z)-5-methylhepta-1,3,5-triene;8-oxo-2-phenylpentadecane-2,14-disulfonic acid |
|---|---|
| PubChem CID | 142212016 |
| Molecular Formula | C29H46O7S2 |
| Molecular Weight | 570.81 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | (3Z,5Z)-5-methylhepta-1,3,5-triene;8-oxo-2-phenylpentadecane-2,14-disulfonic acid |
| SMILES | C=C/C=C\C(C)=C/C.CC(CCCCCC(=O)CCCCCC(C)(c1ccccc1)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C21H34O7S2.C8H12/c1-18(29(23,24)25)12-6-3-9-15-20(22)16-10-5-11-17-21(2,30(26,27)28)19-13-7-4-8-14-19;1-4-6-7-8(3)5-2/h4,7-8,13-14,18H,3,5-6,9-12,15-17H2,1-2H3,(H,23,24,25)(H,26,27,28);4-7H,1H2,2-3H3/b;7-6-,8-5- |
| InChIKey | OYJCVOHXHYKMAV-JLMZEHOHSA-N |
| XLogP | 7.23 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.81 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|