C17H38O2 — CID 142212056
2-(2,2-dimethylhexoxy)oxane;ethane (PubChem CID 142212056) has the molecular formula C17H38O2 and a molecular weight of 274.49 g/mol. Its IUPAC name is 2-(2,2-dimethylhexoxy)oxane;ethane.
| Compound Name | 2-(2,2-dimethylhexoxy)oxane;ethane |
|---|---|
| PubChem CID | 142212056 |
| Molecular Formula | C17H38O2 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.29 |
| IUPAC Name | 2-(2,2-dimethylhexoxy)oxane;ethane |
| SMILES | CC.CC.CCCCC(C)(C)COC1CCCCO1 |
| InChI | InChI=1S/C13H26O2.2C2H6/c1-4-5-9-13(2,3)11-15-12-8-6-7-10-14-12;2*1-2/h12H,4-11H2,1-3H3;2*1-2H3 |
| InChIKey | ULHKPIBUHZYAKW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |