About 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate
2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate (PubChem CID 142212599) has the molecular formula C18H31NO2
and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate |
| PubChem CID | 142212599 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate |
| SMILES | CC.CCCC(C)(C)CN1C(=O)c2ccccc2C1C.O |
| InChI | InChI=1S/C16H23NO.C2H6.H2O/c1-5-10-16(3,4)11-17-12(2)13-8-6-7-9-14(13)15(17)18;1-2;/h6-9,12H,5,10-11H2,1-4H3;1-2H3;1H2 |
| InChIKey | DOWHXNCVNYDFRG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate?
The IUPAC name of 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate (CID 142212599) is 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate.
What is the SMILES notation for 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate?
The canonical SMILES for 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate is CC.CCCC(C)(C)CN1C(=O)c2ccccc2C1C.O.
What is the InChIKey of 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate?
The InChIKey is DOWHXNCVNYDFRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO.C2H6.H2O/c1-5-10-16(3,4)11-17-12(2)13-8-6-7-9-14(13)15(17)18;1-2;/h6-9,12H,5,10-11H2,1-4H3;1-2H3;1H2.
What are the key properties of 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate?
2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate has a molecular weight of 293.45 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpentyl)-3-methyl-3H-isoindol-1-one;ethane;hydrate is sourced from PubChem (CID 142212599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).