C16H28OSi — CID 14221277
(1R,6R)-5,5,6-trimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohex-2-en-1-ol (PubChem CID 14221277) has the molecular formula C16H28OSi and a molecular weight of 264.48 g/mol. Its IUPAC name is (1R,6R)-5,5,6-trimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohex-2-en-1-ol.
| Compound Name | (1R,6R)-5,5,6-trimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 14221277 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.48 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (1R,6R)-5,5,6-trimethyl-3-(4-trimethylsilylbut-3-ynyl)cyclohex-2-en-1-ol |
| SMILES | C[C@H]1[C@H](O)C=C(CCC#C[Si](C)(C)C)CC1(C)C |
| InChI | InChI=1S/C16H28OSi/c1-13-15(17)11-14(12-16(13,2)3)9-7-8-10-18(4,5)6/h11,13,15,17H,7,9,12H2,1-6H3/t13-,15+/m0/s1 |
| InChIKey | DZCRXEMUTKOQON-DZGCQCFKSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|