N-butylpyrimidin-2-amine;molecular hydrogen

C8H15N3 — CID 142213040

IUPACN-butylpyrimidin-2-amine;molecular hydrogen
SMILESCCCCNc1ncccn1.[H][H]
InChIInChI=1S/C8H13N3.H2/c1-2-3-5-9-8-10-6-4-7-11-8;/h4,6-7H,2-3,5H2,1H3,(H,9,10,11);1H
InChIKeyXNIUIEPWVVCPAG-UHFFFAOYSA-N
MW153.23 g/mol
LogP1.93
Rot. Bonds4

About N-butylpyrimidin-2-amine;molecular hydrogen

N-butylpyrimidin-2-amine;molecular hydrogen (PubChem CID 142213040) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N-butylpyrimidin-2-amine;molecular hydrogen.

Molecular Properties

Compound NameN-butylpyrimidin-2-amine;molecular hydrogen
PubChem CID142213040
Molecular FormulaC8H15N3
Molecular Weight153.23 g/mol
Exact Mass153.13
IUPAC NameN-butylpyrimidin-2-amine;molecular hydrogen
SMILESCCCCNc1ncccn1.[H][H]
InChIInChI=1S/C8H13N3.H2/c1-2-3-5-9-8-10-6-4-7-11-8;/h4,6-7H,2-3,5H2,1H3,(H,9,10,11);1H
InChIKeyXNIUIEPWVVCPAG-UHFFFAOYSA-N
XLogP1.93
TPSA37.81 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.23
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze N-butylpyrimidin-2-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-butylpyrimidin-2-amine;molecular hydrogen?
The IUPAC name of N-butylpyrimidin-2-amine;molecular hydrogen (CID 142213040) is N-butylpyrimidin-2-amine;molecular hydrogen.
What is the SMILES notation for N-butylpyrimidin-2-amine;molecular hydrogen?
The canonical SMILES for N-butylpyrimidin-2-amine;molecular hydrogen is CCCCNc1ncccn1.[H][H].
What is the InChIKey of N-butylpyrimidin-2-amine;molecular hydrogen?
The InChIKey is XNIUIEPWVVCPAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3.H2/c1-2-3-5-9-8-10-6-4-7-11-8;/h4,6-7H,2-3,5H2,1H3,(H,9,10,11);1H.
What are the key properties of N-butylpyrimidin-2-amine;molecular hydrogen?
N-butylpyrimidin-2-amine;molecular hydrogen has a molecular weight of 153.23 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylpyrimidin-2-amine;molecular hydrogen is sourced from PubChem (CID 142213040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).