C23H31N3O2 — CID 142213051
(2S,5R)-2-(4-aminobutyl)-1-ethyl-5-(naphthalen-2-yloxymethyl)-5,6,7,7a-tetrahydro-2H-pyrrolo[1,2-a]imidazol-3-one (PubChem CID 142213051) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is (2S,5R)-2-(4-aminobutyl)-1-ethyl-5-(naphthalen-2-yloxymethyl)-5,6,7,7a-tetrahydro-2H-pyrrolo[1,2-a]imidazol-3-one.
| Compound Name | (2S,5R)-2-(4-aminobutyl)-1-ethyl-5-(naphthalen-2-yloxymethyl)-5,6,7,7a-tetrahydro-2H-pyrrolo[1,2-a]imidazol-3-one |
|---|---|
| PubChem CID | 142213051 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | (2S,5R)-2-(4-aminobutyl)-1-ethyl-5-(naphthalen-2-yloxymethyl)-5,6,7,7a-tetrahydro-2H-pyrrolo[1,2-a]imidazol-3-one |
| SMILES | CCN1C2CC[C@H](COc3ccc4ccccc4c3)N2C(=O)[C@@H]1CCCCN |
| InChI | InChI=1S/C23H31N3O2/c1-2-25-21(9-5-6-14-24)23(27)26-19(11-13-22(25)26)16-28-20-12-10-17-7-3-4-8-18(17)15-20/h3-4,7-8,10,12,15,19,21-22H,2,5-6,9,11,13-14,16,24H2,1H3/t19-,21+,22?/m1/s1 |
| InChIKey | LCOVNDKIRVQZLT-DOYJUQJDSA-N |
| XLogP | 3.37 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|