C11H14N2S — CID 142213206
4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione (PubChem CID 142213206) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 142213206 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione |
| SMILES | C=Cc1[nH]c(=S)[nH]c1/C=C\C(C)C=C |
| InChI | InChI=1S/C11H14N2S/c1-4-8(3)6-7-10-9(5-2)12-11(14)13-10/h4-8H,1-2H2,3H3,(H2,12,13,14)/b7-6- |
| InChIKey | YKASFKUIIKLUAM-SREVYHEPSA-N |
| XLogP | 3.55 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|