About 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione
4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione (PubChem CID 142213206) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione.
Molecular Properties
| Compound Name | 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione |
| PubChem CID | 142213206 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione |
| SMILES | C=Cc1[nH]c(=S)[nH]c1/C=C\C(C)C=C |
| InChI | InChI=1S/C11H14N2S/c1-4-8(3)6-7-10-9(5-2)12-11(14)13-10/h4-8H,1-2H2,3H3,(H2,12,13,14)/b7-6- |
| InChIKey | YKASFKUIIKLUAM-SREVYHEPSA-N |
| XLogP | 3.55 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione?
The IUPAC name of 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione (CID 142213206) is 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione.
What is the SMILES notation for 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione?
The canonical SMILES for 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione is C=Cc1[nH]c(=S)[nH]c1/C=C\C(C)C=C.
What is the InChIKey of 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione?
The InChIKey is YKASFKUIIKLUAM-SREVYHEPSA-N. The full InChI is InChI=1S/C11H14N2S/c1-4-8(3)6-7-10-9(5-2)12-11(14)13-10/h4-8H,1-2H2,3H3,(H2,12,13,14)/b7-6-.
What are the key properties of 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione?
4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione has a molecular weight of 206.31 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-5-[(1Z)-3-methylpenta-1,4-dienyl]-1,3-dihydroimidazole-2-thione is sourced from PubChem (CID 142213206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).