C12H19NO — CID 142213470
(2E,4Z)-N-(3-methoxyprop-1-en-2-yl)-6-methylhepta-2,4,6-trien-3-amine (PubChem CID 142213470) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (2E,4Z)-N-(3-methoxyprop-1-en-2-yl)-6-methylhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-N-(3-methoxyprop-1-en-2-yl)-6-methylhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 142213470 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2E,4Z)-N-(3-methoxyprop-1-en-2-yl)-6-methylhepta-2,4,6-trien-3-amine |
| SMILES | C=C(C)/C=C\C(=C/C)NC(=C)COC |
| InChI | InChI=1S/C12H19NO/c1-6-12(8-7-10(2)3)13-11(4)9-14-5/h6-8,13H,2,4,9H2,1,3,5H3/b8-7-,12-6+ |
| InChIKey | BTOACXFCGHUWAD-HRZQEMGZSA-N |
| XLogP | 2.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|