C7H13NO2 — CID 14221363
2,5-dimethylpyrrolidine-3-carboxylic acid (PubChem CID 14221363) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 2,5-dimethylpyrrolidine-3-carboxylic acid.
| Compound Name | 2,5-dimethylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 14221363 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2,5-dimethylpyrrolidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)C(C)N1 |
| InChI | InChI=1S/C7H13NO2/c1-4-3-6(7(9)10)5(2)8-4/h4-6,8H,3H2,1-2H3,(H,9,10) |
| InChIKey | GRQXIULZFCBQKO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |