About 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine
1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine (PubChem CID 142214762) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine.
Molecular Properties
| Compound Name | 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine |
| PubChem CID | 142214762 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine |
| SMILES | C/C=c1/c(CC(C)N)co/c1=C/CC |
| InChI | InChI=1S/C12H19NO/c1-4-6-12-11(5-2)10(8-14-12)7-9(3)13/h5-6,8-9H,4,7,13H2,1-3H3/b11-5-,12-6+ |
| InChIKey | YTDHHRXSVLEKOE-JTAXDKCCSA-N |
| XLogP | 1.16 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine?
The IUPAC name of 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine (CID 142214762) is 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine.
What is the SMILES notation for 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine?
The canonical SMILES for 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine is C/C=c1/c(CC(C)N)co/c1=C/CC.
What is the InChIKey of 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine?
The InChIKey is YTDHHRXSVLEKOE-JTAXDKCCSA-N. The full InChI is InChI=1S/C12H19NO/c1-4-6-12-11(5-2)10(8-14-12)7-9(3)13/h5-6,8-9H,4,7,13H2,1-3H3/b11-5-,12-6+.
What are the key properties of 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine?
1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine has a molecular weight of 193.29 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4Z,5E)-4-ethylidene-5-propylidenefuran-3-yl]propan-2-amine is sourced from PubChem (CID 142214762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).