C10H14N2O — CID 142215025
(5E)-3-methyl-5-[(Z)-pent-2-enylidene]-1,4-dihydropyridazin-6-one (PubChem CID 142215025) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (5E)-3-methyl-5-[(Z)-pent-2-enylidene]-1,4-dihydropyridazin-6-one.
| Compound Name | (5E)-3-methyl-5-[(Z)-pent-2-enylidene]-1,4-dihydropyridazin-6-one |
|---|---|
| PubChem CID | 142215025 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (5E)-3-methyl-5-[(Z)-pent-2-enylidene]-1,4-dihydropyridazin-6-one |
| SMILES | CC/C=C\C=C1/CC(C)=NNC1=O |
| InChI | InChI=1S/C10H14N2O/c1-3-4-5-6-9-7-8(2)11-12-10(9)13/h4-6H,3,7H2,1-2H3,(H,12,13)/b5-4-,9-6+ |
| InChIKey | FLRSTEDGGAEQBX-KMOPYBJPSA-N |
| XLogP | 1.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|