About 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol
5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol (PubChem CID 142215212) has the molecular formula C11H17N5O
and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol.
Molecular Properties
| Compound Name | 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol |
| PubChem CID | 142215212 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol |
| SMILES | CNCCC/N=C1/NC(N)(O)c2cccnc21 |
| InChI | InChI=1S/C11H17N5O/c1-13-5-3-7-15-10-9-8(4-2-6-14-9)11(12,17)16-10/h2,4,6,13,17H,3,5,7,12H2,1H3,(H,15,16) |
| InChIKey | DYUFFMVUSADMNM-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol?
The IUPAC name of 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol (CID 142215212) is 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol.
What is the SMILES notation for 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol?
The canonical SMILES for 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol is CNCCC/N=C1/NC(N)(O)c2cccnc21.
What is the InChIKey of 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol?
The InChIKey is DYUFFMVUSADMNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O/c1-13-5-3-7-15-10-9-8(4-2-6-14-9)11(12,17)16-10/h2,4,6,13,17H,3,5,7,12H2,1H3,(H,15,16).
What are the key properties of 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol?
5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol has a molecular weight of 235.29 g/mol, XLogP of -0.90, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-7-[3-(methylamino)propylimino]-6H-pyrrolo[3,4-b]pyridin-5-ol is sourced from PubChem (CID 142215212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).