C14H19N3OS — CID 142215501
N-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide (PubChem CID 142215501) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is N-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 142215501 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]-1,3-thiazol-2-yl]pyrrolidine-1-carboxamide |
| SMILES | C/C=C\C(=C/C)c1cnc(NC(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C14H19N3OS/c1-3-7-11(4-2)12-10-15-13(19-12)16-14(18)17-8-5-6-9-17/h3-4,7,10H,5-6,8-9H2,1-2H3,(H,15,16,18)/b7-3-,11-4+ |
| InChIKey | SZTCZMKWLONVRU-VGQHJLIWSA-N |
| XLogP | 3.75 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|