C12H22F3LiN4O2 — CID 142216035
lithium [2-methylpropyl-[2-[2-methylpropyl-[(2,2,2-trifluoroacetyl)amino]amino]-2-oxoethyl]amino]azanide (PubChem CID 142216035) has the molecular formula C12H22F3LiN4O2 and a molecular weight of 318.27 g/mol. Its IUPAC name is lithium [2-methylpropyl-[2-[2-methylpropyl-[(2,2,2-trifluoroacetyl)amino]amino]-2-oxoethyl]amino]azanide.
| Compound Name | lithium [2-methylpropyl-[2-[2-methylpropyl-[(2,2,2-trifluoroacetyl)amino]amino]-2-oxoethyl]amino]azanide |
|---|---|
| PubChem CID | 142216035 |
| Molecular Formula | C12H22F3LiN4O2 |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | lithium [2-methylpropyl-[2-[2-methylpropyl-[(2,2,2-trifluoroacetyl)amino]amino]-2-oxoethyl]amino]azanide |
| SMILES | CC(C)CN([NH-])CC(=O)N(CC(C)C)NC(=O)C(F)(F)F.[Li+] |
| InChI | InChI=1S/C12H22F3N4O2.Li/c1-8(2)5-18(16)7-10(20)19(6-9(3)4)17-11(21)12(13,14)15;/h8-9,16H,5-7H2,1-4H3,(H,17,21);/q-1;+1 |
| InChIKey | XIHDXOPRZFOLGY-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|