About azane;methylcarbamodithioic acid
azane;methylcarbamodithioic acid (PubChem CID 14221609) has the molecular formula C2H8N2S2
and a molecular weight of 124.23 g/mol. Its IUPAC name is azane;methylcarbamodithioic acid.
Molecular Properties
| Compound Name | azane;methylcarbamodithioic acid |
| PubChem CID | 14221609 |
| Molecular Formula | C2H8N2S2 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.01 |
| IUPAC Name | azane;methylcarbamodithioic acid |
| SMILES | CNC(=S)S.N |
| InChI | InChI=1S/C2H5NS2.H3N/c1-3-2(4)5;/h1H3,(H2,3,4,5);1H3 |
| InChIKey | LVYAMPSKHSIFNV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;methylcarbamodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methylcarbamodithioic acid?
The IUPAC name of azane;methylcarbamodithioic acid (CID 14221609) is azane;methylcarbamodithioic acid.
What is the SMILES notation for azane;methylcarbamodithioic acid?
The canonical SMILES for azane;methylcarbamodithioic acid is CNC(=S)S.N.
What is the InChIKey of azane;methylcarbamodithioic acid?
The InChIKey is LVYAMPSKHSIFNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NS2.H3N/c1-3-2(4)5;/h1H3,(H2,3,4,5);1H3.
What are the key properties of azane;methylcarbamodithioic acid?
azane;methylcarbamodithioic acid has a molecular weight of 124.23 g/mol, XLogP of 0.58, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methylcarbamodithioic acid is sourced from PubChem (CID 14221609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).