About (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol
(1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol (PubChem CID 142216497) has the molecular formula C15H19NS
and a molecular weight of 245.39 g/mol. Its IUPAC name is (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol.
Molecular Properties
| Compound Name | (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol |
| PubChem CID | 142216497 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol |
| SMILES | C=CCC(C=C)/C=C(\S)c1ccccc1NC |
| InChI | InChI=1S/C15H19NS/c1-4-8-12(5-2)11-15(17)13-9-6-7-10-14(13)16-3/h4-7,9-12,16-17H,1-2,8H2,3H3/b15-11- |
| InChIKey | OJMMFGDNSYHKKF-PTNGSMBKSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol?
The IUPAC name of (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol (CID 142216497) is (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol.
What is the SMILES notation for (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol?
The canonical SMILES for (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol is C=CCC(C=C)/C=C(\S)c1ccccc1NC.
What is the InChIKey of (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol?
The InChIKey is OJMMFGDNSYHKKF-PTNGSMBKSA-N. The full InChI is InChI=1S/C15H19NS/c1-4-8-12(5-2)11-15(17)13-9-6-7-10-14(13)16-3/h4-7,9-12,16-17H,1-2,8H2,3H3/b15-11-.
What are the key properties of (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol?
(1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol has a molecular weight of 245.39 g/mol, XLogP of 4.38, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-3-ethenyl-1-[2-(methylamino)phenyl]hexa-1,5-diene-1-thiol is sourced from PubChem (CID 142216497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).