2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid

C11H15NO2 — CID 142216658

IUPAC2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid
SMILESCC(C(=O)O)C1=CC=CC(C)(N)C=C1
InChIInChI=1S/C11H15NO2/c1-8(10(13)14)9-4-3-6-11(2,12)7-5-9/h3-8H,12H2,1-2H3,(H,13,14)
InChIKeyBWIIPDKEFOHORN-UHFFFAOYSA-N
MW193.25 g/mol
LogP1.48
Rot. Bonds2

About 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid

2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid (PubChem CID 142216658) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid.

Molecular Properties

Compound Name2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid
PubChem CID142216658
Molecular FormulaC11H15NO2
Molecular Weight193.25 g/mol
Exact Mass193.11
IUPAC Name2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid
SMILESCC(C(=O)O)C1=CC=CC(C)(N)C=C1
InChIInChI=1S/C11H15NO2/c1-8(10(13)14)9-4-3-6-11(2,12)7-5-9/h3-8H,12H2,1-2H3,(H,13,14)
InChIKeyBWIIPDKEFOHORN-UHFFFAOYSA-N
XLogP1.48
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.25
LogP ≤ 51.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid?
The IUPAC name of 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid (CID 142216658) is 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid.
What is the SMILES notation for 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid?
The canonical SMILES for 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid is CC(C(=O)O)C1=CC=CC(C)(N)C=C1.
What is the InChIKey of 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid?
The InChIKey is BWIIPDKEFOHORN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-8(10(13)14)9-4-3-6-11(2,12)7-5-9/h3-8H,12H2,1-2H3,(H,13,14).
What are the key properties of 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid?
2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid has a molecular weight of 193.25 g/mol, XLogP of 1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-5-methylcyclohepta-1,3,6-trien-1-yl)propanoic acid is sourced from PubChem (CID 142216658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).