C34H46N2O2 — CID 142216881
ethane;[(R)-[(2S,5R)-5-ethylpiperidin-2-yl]-quinolin-4-ylmethyl] 3-cyclohexyl-2-phenylpropanoate (PubChem CID 142216881) has the molecular formula C34H46N2O2 and a molecular weight of 514.75 g/mol. Its IUPAC name is ethane;[(R)-[(2S,5R)-5-ethylpiperidin-2-yl]-quinolin-4-ylmethyl] 3-cyclohexyl-2-phenylpropanoate.
| Compound Name | ethane;[(R)-[(2S,5R)-5-ethylpiperidin-2-yl]-quinolin-4-ylmethyl] 3-cyclohexyl-2-phenylpropanoate |
|---|---|
| PubChem CID | 142216881 |
| Molecular Formula | C34H46N2O2 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.36 |
| IUPAC Name | ethane;[(R)-[(2S,5R)-5-ethylpiperidin-2-yl]-quinolin-4-ylmethyl] 3-cyclohexyl-2-phenylpropanoate |
| SMILES | CC.CC[C@@H]1CC[C@@H]([C@H](OC(=O)C(CC2CCCCC2)c2ccccc2)c2ccnc3ccccc23)NC1 |
| InChI | InChI=1S/C32H40N2O2.C2H6/c1-2-23-17-18-30(34-22-23)31(27-19-20-33-29-16-10-9-15-26(27)29)36-32(35)28(25-13-7-4-8-14-25)21-24-11-5-3-6-12-24;1-2/h4,7-10,13-16,19-20,23-24,28,30-31,34H,2-3,5-6,11-12,17-18,21-22H2,1H3;1-2H3/t23-,28?,30+,31-;/m1./s1 |
| InChIKey | OAHUYVKOWMTPDV-FHIRYZETSA-N |
| XLogP | 8.38 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |