C19H25N2- — CID 142216900
4-[[(2R,4S,5R)-4,5-diethylpiperidin-1-id-2-yl]methyl]quinoline (PubChem CID 142216900) has the molecular formula C19H25N2- and a molecular weight of 281.42 g/mol. Its IUPAC name is 4-[[(2R,4S,5R)-4,5-diethylpiperidin-1-id-2-yl]methyl]quinoline.
| Compound Name | 4-[[(2R,4S,5R)-4,5-diethylpiperidin-1-id-2-yl]methyl]quinoline |
|---|---|
| PubChem CID | 142216900 |
| Molecular Formula | C19H25N2- |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 4-[[(2R,4S,5R)-4,5-diethylpiperidin-1-id-2-yl]methyl]quinoline |
| SMILES | CC[C@H]1C[N-][C@@H](Cc2ccnc3ccccc23)C[C@@H]1CC |
| InChI | InChI=1S/C19H25N2/c1-3-14-11-17(21-13-15(14)4-2)12-16-9-10-20-19-8-6-5-7-18(16)19/h5-10,14-15,17H,3-4,11-13H2,1-2H3/q-1/t14-,15-,17+/m0/s1 |
| InChIKey | HMFVRBXGSVXVTF-YQQAZPJKSA-N |
| XLogP | 4.98 |
| TPSA | 26.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |