C10H19NO3 — CID 142217191
2-(2-methoxyethoxy)-N-pent-4-enylacetamide (PubChem CID 142217191) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-pent-4-enylacetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-pent-4-enylacetamide |
|---|---|
| PubChem CID | 142217191 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-pent-4-enylacetamide |
| SMILES | C=CCCCNC(=O)COCCOC |
| InChI | InChI=1S/C10H19NO3/c1-3-4-5-6-11-10(12)9-14-8-7-13-2/h3H,1,4-9H2,2H3,(H,11,12) |
| InChIKey | IGJZQZMZQAJHQA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|