C19H28N6 — CID 142217327
1-cyano-N'-[(1E,3Z)-5-(2,6-dimethylidenepiperazin-1-yl)-4-(2,2-dimethylpropylamino)penta-1,3-dienyl]-N-methylidenemethanimidamide (PubChem CID 142217327) has the molecular formula C19H28N6 and a molecular weight of 340.48 g/mol. Its IUPAC name is 1-cyano-N'-[(1E,3Z)-5-(2,6-dimethylidenepiperazin-1-yl)-4-(2,2-dimethylpropylamino)penta-1,3-dienyl]-N-methylidenemethanimidamide.
| Compound Name | 1-cyano-N'-[(1E,3Z)-5-(2,6-dimethylidenepiperazin-1-yl)-4-(2,2-dimethylpropylamino)penta-1,3-dienyl]-N-methylidenemethanimidamide |
|---|---|
| PubChem CID | 142217327 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1-cyano-N'-[(1E,3Z)-5-(2,6-dimethylidenepiperazin-1-yl)-4-(2,2-dimethylpropylamino)penta-1,3-dienyl]-N-methylidenemethanimidamide |
| SMILES | C=N/C(C#N)=N/C=C/C=C(/CN1C(=C)CNCC1=C)NCC(C)(C)C |
| InChI | InChI=1S/C19H28N6/c1-15-11-22-12-16(2)25(15)13-17(24-14-19(3,4)5)8-7-9-23-18(10-20)21-6/h7-9,22,24H,1-2,6,11-14H2,3-5H3/b9-7+,17-8-,23-18+ |
| InChIKey | LBRRMVQFQFLWMS-MOKHFBITSA-N |
| XLogP | 2.57 |
| TPSA | 75.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|