C22H32N6O — CID 142217374
4-[(4-butanoylpiperazin-1-yl)methyl]-5-(2,2-dimethylpropyl)-5,7,9-triazatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-8-carbonitrile (PubChem CID 142217374) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[(4-butanoylpiperazin-1-yl)methyl]-5-(2,2-dimethylpropyl)-5,7,9-triazatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-8-carbonitrile.
| Compound Name | 4-[(4-butanoylpiperazin-1-yl)methyl]-5-(2,2-dimethylpropyl)-5,7,9-triazatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-8-carbonitrile |
|---|---|
| PubChem CID | 142217374 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 4-[(4-butanoylpiperazin-1-yl)methyl]-5-(2,2-dimethylpropyl)-5,7,9-triazatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-8-carbonitrile |
| SMILES | CCCC(=O)N1CCN(CC23CC2c2cnc(C#N)nc2N3CC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H32N6O/c1-5-6-19(29)27-9-7-26(8-10-27)15-22-11-17(22)16-13-24-18(12-23)25-20(16)28(22)14-21(2,3)4/h13,17H,5-11,14-15H2,1-4H3 |
| InChIKey | ONBAJFZYXPXZIB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |