C12H13F3N2O2S — CID 142217560
2-(6,6,6-trifluorohexylamino)thieno[2,3-d][1,3]oxazin-4-one (PubChem CID 142217560) has the molecular formula C12H13F3N2O2S and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-(6,6,6-trifluorohexylamino)thieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 2-(6,6,6-trifluorohexylamino)thieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 142217560 |
| Molecular Formula | C12H13F3N2O2S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(6,6,6-trifluorohexylamino)thieno[2,3-d][1,3]oxazin-4-one |
| SMILES | O=c1oc(NCCCCCC(F)(F)F)nc2sccc12 |
| InChI | InChI=1S/C12H13F3N2O2S/c13-12(14,15)5-2-1-3-6-16-11-17-9-8(4-7-20-9)10(18)19-11/h4,7H,1-3,5-6H2,(H,16,17) |
| InChIKey | NYWBEUFPTIAPOF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|