C22H30NO2- — CID 142218291
1-[2-[(3aR,7aS)-7a-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-yl]propyl]-2-phenylcyclopropane-1-carboxylate (PubChem CID 142218291) has the molecular formula C22H30NO2- and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-[2-[(3aR,7aS)-7a-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-yl]propyl]-2-phenylcyclopropane-1-carboxylate.
| Compound Name | 1-[2-[(3aR,7aS)-7a-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-yl]propyl]-2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 142218291 |
| Molecular Formula | C22H30NO2- |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 1-[2-[(3aR,7aS)-7a-methyl-3,3a,4,5,6,7-hexahydro-1H-isoindol-2-yl]propyl]-2-phenylcyclopropane-1-carboxylate |
| SMILES | CC(CC1(C(=O)[O-])CC1c1ccccc1)N1C[C@@H]2CCCC[C@]2(C)C1 |
| InChI | InChI=1S/C22H31NO2/c1-16(23-14-18-10-6-7-11-21(18,2)15-23)12-22(20(24)25)13-19(22)17-8-4-3-5-9-17/h3-5,8-9,16,18-19H,6-7,10-15H2,1-2H3,(H,24,25)/p-1/t16?,18-,19?,21+,22?/m0/s1 |
| InChIKey | PEOLZHGMQFNIGG-USBFEZLMSA-M |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |