About 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane
4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane (PubChem CID 142218838) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane.
Molecular Properties
| Compound Name | 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane |
| PubChem CID | 142218838 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane |
| SMILES | C=Cc1[nH]c(=O)oc1C=C.CC |
| InChI | InChI=1S/C7H7NO2.C2H6/c1-3-5-6(4-2)10-7(9)8-5;1-2/h3-4H,1-2H2,(H,8,9);1-2H3 |
| InChIKey | PTCCSZJMOCXTPT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane?
The IUPAC name of 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane (CID 142218838) is 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane.
What is the SMILES notation for 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane?
The canonical SMILES for 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane is C=Cc1[nH]c(=O)oc1C=C.CC.
What is the InChIKey of 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane?
The InChIKey is PTCCSZJMOCXTPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C2H6/c1-3-5-6(4-2)10-7(9)8-5;1-2/h3-4H,1-2H2,(H,8,9);1-2H3.
What are the key properties of 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane?
4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane has a molecular weight of 167.21 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenyl)-3H-1,3-oxazol-2-one;ethane is sourced from PubChem (CID 142218838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).