C34H46O4 — CID 142218902
(3Z,7E,9E,12E,14E)-15-tert-butyl-7-ethenyl-5-methylidene-2-[4-[(2-methylpropan-2-yl)oxy]cyclohexyl]oxyheptadeca-1,3,7,9,12,14,16-heptaene-6,11-dione (PubChem CID 142218902) has the molecular formula C34H46O4 and a molecular weight of 518.74 g/mol. Its IUPAC name is (3Z,7E,9E,12E,14E)-15-tert-butyl-7-ethenyl-5-methylidene-2-[4-[(2-methylpropan-2-yl)oxy]cyclohexyl]oxyheptadeca-1,3,7,9,12,14,16-heptaene-6,11-dione.
| Compound Name | (3Z,7E,9E,12E,14E)-15-tert-butyl-7-ethenyl-5-methylidene-2-[4-[(2-methylpropan-2-yl)oxy]cyclohexyl]oxyheptadeca-1,3,7,9,12,14,16-heptaene-6,11-dione |
|---|---|
| PubChem CID | 142218902 |
| Molecular Formula | C34H46O4 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | (3Z,7E,9E,12E,14E)-15-tert-butyl-7-ethenyl-5-methylidene-2-[4-[(2-methylpropan-2-yl)oxy]cyclohexyl]oxyheptadeca-1,3,7,9,12,14,16-heptaene-6,11-dione |
| SMILES | C=C/C(=C\C=C\C(=O)/C=C/C=C(\C=C)C(C)(C)C)C(=O)C(=C)/C=C\C(=C)OC1CCC(OC(C)(C)C)CC1 |
| InChI | InChI=1S/C34H46O4/c1-11-27(15-13-17-29(35)18-14-16-28(12-2)33(5,6)7)32(36)25(3)19-20-26(4)37-30-21-23-31(24-22-30)38-34(8,9)10/h11-20,30-31H,1-4,21-24H2,5-10H3/b17-13+,18-14+,20-19-,27-15+,28-16+ |
| InChIKey | QJWLTXNUKRJEBQ-JVCUVVLMSA-N |
| XLogP | 8.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|