About 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane
4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane (PubChem CID 142219128) has the molecular formula C22H30Cl2N4O2S
and a molecular weight of 485.48 g/mol. Its IUPAC name is 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane.
Molecular Properties
| Compound Name | 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane |
| PubChem CID | 142219128 |
| Molecular Formula | C22H30Cl2N4O2S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane |
| SMILES | CC.CC.CN(c1cc(Cl)cc(Cl)c1)c1ccc(C#N)cc1S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C18H18Cl2N4O2S.2C2H6/c1-23(16-10-14(19)9-15(20)11-16)17-3-2-13(12-21)8-18(17)27(25,26)24-6-4-22-5-7-24;2*1-2/h2-3,8-11,22H,4-7H2,1H3;2*1-2H3 |
| InChIKey | BIIFPNZBTJRCTP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane?
The IUPAC name of 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane (CID 142219128) is 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane.
What is the SMILES notation for 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane?
The canonical SMILES for 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane is CC.CC.CN(c1cc(Cl)cc(Cl)c1)c1ccc(C#N)cc1S(=O)(=O)N1CCNCC1.
What is the InChIKey of 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane?
The InChIKey is BIIFPNZBTJRCTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2N4O2S.2C2H6/c1-23(16-10-14(19)9-15(20)11-16)17-3-2-13(12-21)8-18(17)27(25,26)24-6-4-22-5-7-24;2*1-2/h2-3,8-11,22H,4-7H2,1H3;2*1-2H3.
What are the key properties of 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane?
4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane has a molecular weight of 485.48 g/mol, XLogP of 5.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dichloro-N-methylanilino)-3-piperazin-1-ylsulfonylbenzonitrile;ethane is sourced from PubChem (CID 142219128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).