About [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate
[3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate (PubChem CID 142219286) has the molecular formula C11H11BrFNO3S
and a molecular weight of 336.18 g/mol. Its IUPAC name is [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate.
Molecular Properties
| Compound Name | [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate |
| PubChem CID | 142219286 |
| Molecular Formula | C11H11BrFNO3S |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate |
| SMILES | CS(=O)OCC1CC(c2ccc(Br)c(F)c2)=NO1 |
| InChI | InChI=1S/C11H11BrFNO3S/c1-18(15)16-6-8-5-11(14-17-8)7-2-3-9(12)10(13)4-7/h2-4,8H,5-6H2,1H3 |
| InChIKey | IJXSNKDJLVPIRM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate?
The IUPAC name of [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate (CID 142219286) is [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate.
What is the SMILES notation for [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate?
The canonical SMILES for [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate is CS(=O)OCC1CC(c2ccc(Br)c(F)c2)=NO1.
What is the InChIKey of [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate?
The InChIKey is IJXSNKDJLVPIRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrFNO3S/c1-18(15)16-6-8-5-11(14-17-8)7-2-3-9(12)10(13)4-7/h2-4,8H,5-6H2,1H3.
What are the key properties of [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate?
[3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate has a molecular weight of 336.18 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-bromo-3-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl methanesulfinate is sourced from PubChem (CID 142219286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).