About [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate
[1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate (PubChem CID 14222005) has the molecular formula C20H18N2O4
and a molecular weight of 350.37 g/mol. Its IUPAC name is [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate.
Molecular Properties
| Compound Name | [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate |
| PubChem CID | 14222005 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate |
| SMILES | C=CCc1c(OC(C)=O)c2cccnc2n(-c2cccc(OC)c2)c1=O |
| InChI | InChI=1S/C20H18N2O4/c1-4-7-17-18(26-13(2)23)16-10-6-11-21-19(16)22(20(17)24)14-8-5-9-15(12-14)25-3/h4-6,8-12H,1,7H2,2-3H3 |
| InChIKey | UAFIVMCBARWLAD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate?
The IUPAC name of [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate (CID 14222005) is [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate.
What is the SMILES notation for [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate?
The canonical SMILES for [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate is C=CCc1c(OC(C)=O)c2cccnc2n(-c2cccc(OC)c2)c1=O.
What is the InChIKey of [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate?
The InChIKey is UAFIVMCBARWLAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O4/c1-4-7-17-18(26-13(2)23)16-10-6-11-21-19(16)22(20(17)24)14-8-5-9-15(12-14)25-3/h4-6,8-12H,1,7H2,2-3H3.
What are the key properties of [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate?
[1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate has a molecular weight of 350.37 g/mol, XLogP of 3.05, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate is sourced from PubChem (CID 14222005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).