C20H18N2O4 — CID 14222006
[1-(4-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate (PubChem CID 14222006) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate.
| Compound Name | [1-(4-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate |
|---|---|
| PubChem CID | 14222006 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [1-(4-methoxyphenyl)-2-oxo-3-prop-2-enyl-1,8-naphthyridin-4-yl] acetate |
| SMILES | C=CCc1c(OC(C)=O)c2cccnc2n(-c2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C20H18N2O4/c1-4-6-17-18(26-13(2)23)16-7-5-12-21-19(16)22(20(17)24)14-8-10-15(25-3)11-9-14/h4-5,7-12H,1,6H2,2-3H3 |
| InChIKey | YJCNNKCOCZDSBR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|