About ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide
ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide (PubChem CID 142220290) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide.
Molecular Properties
| Compound Name | ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide |
| PubChem CID | 142220290 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide |
| SMILES | CC.CC/C(C)=C/CC(O)C(=O)N(C)OC |
| InChI | InChI=1S/C10H19NO3.C2H6/c1-5-8(2)6-7-9(12)10(13)11(3)14-4;1-2/h6,9,12H,5,7H2,1-4H3;1-2H3/b8-6+; |
| InChIKey | MODLFCPXEWTAPI-WVLIHFOGSA-N |
| XLogP | 2.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide?
The IUPAC name of ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide (CID 142220290) is ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide.
What is the SMILES notation for ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide?
The canonical SMILES for ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide is CC.CC/C(C)=C/CC(O)C(=O)N(C)OC.
What is the InChIKey of ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide?
The InChIKey is MODLFCPXEWTAPI-WVLIHFOGSA-N. The full InChI is InChI=1S/C10H19NO3.C2H6/c1-5-8(2)6-7-9(12)10(13)11(3)14-4;1-2/h6,9,12H,5,7H2,1-4H3;1-2H3/b8-6+;.
What are the key properties of ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide?
ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide has a molecular weight of 231.34 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-2-hydroxy-N-methoxy-N,5-dimethylhept-4-enamide is sourced from PubChem (CID 142220290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).