C9H14F3NO3 — CID 142220293
(E,2S)-6,6,6-trifluoro-2-hydroxy-N-methoxy-N,5-dimethylhex-4-enamide (PubChem CID 142220293) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is (E,2S)-6,6,6-trifluoro-2-hydroxy-N-methoxy-N,5-dimethylhex-4-enamide.
| Compound Name | (E,2S)-6,6,6-trifluoro-2-hydroxy-N-methoxy-N,5-dimethylhex-4-enamide |
|---|---|
| PubChem CID | 142220293 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (E,2S)-6,6,6-trifluoro-2-hydroxy-N-methoxy-N,5-dimethylhex-4-enamide |
| SMILES | CON(C)C(=O)[C@@H](O)C/C=C(\C)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO3/c1-6(9(10,11)12)4-5-7(14)8(15)13(2)16-3/h4,7,14H,5H2,1-3H3/b6-4+/t7-/m0/s1 |
| InChIKey | LUDKNNHZVUJTDG-KNIZRNDPSA-N |
| XLogP | 1.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|