C13H16BrN5O — CID 142220729
N-[(5-bromofuran-3-yl)methyl]-2-methyl-7H-purin-6-amine;ethane (PubChem CID 142220729) has the molecular formula C13H16BrN5O and a molecular weight of 338.21 g/mol. Its IUPAC name is N-[(5-bromofuran-3-yl)methyl]-2-methyl-7H-purin-6-amine;ethane.
| Compound Name | N-[(5-bromofuran-3-yl)methyl]-2-methyl-7H-purin-6-amine;ethane |
|---|---|
| PubChem CID | 142220729 |
| Molecular Formula | C13H16BrN5O |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-[(5-bromofuran-3-yl)methyl]-2-methyl-7H-purin-6-amine;ethane |
| SMILES | CC.Cc1nc(NCc2coc(Br)c2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H10BrN5O.C2H6/c1-6-16-10(9-11(17-6)15-5-14-9)13-3-7-2-8(12)18-4-7;1-2/h2,4-5H,3H2,1H3,(H2,13,14,15,16,17);1-2H3 |
| InChIKey | MGYRJHQHXGTSQB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |