C21H24ClNO5 — CID 142220758
2-[(2Z,4Z)-2-chlorohepta-2,4-dien-3-yl]-5,7-dihydroxy-8-(3-hydroxypiperidin-4-yl)chromen-4-one (PubChem CID 142220758) has the molecular formula C21H24ClNO5 and a molecular weight of 405.88 g/mol. Its IUPAC name is 2-[(2Z,4Z)-2-chlorohepta-2,4-dien-3-yl]-5,7-dihydroxy-8-(3-hydroxypiperidin-4-yl)chromen-4-one.
| Compound Name | 2-[(2Z,4Z)-2-chlorohepta-2,4-dien-3-yl]-5,7-dihydroxy-8-(3-hydroxypiperidin-4-yl)chromen-4-one |
|---|---|
| PubChem CID | 142220758 |
| Molecular Formula | C21H24ClNO5 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[(2Z,4Z)-2-chlorohepta-2,4-dien-3-yl]-5,7-dihydroxy-8-(3-hydroxypiperidin-4-yl)chromen-4-one |
| SMILES | CC/C=C\C(=C(/C)Cl)c1cc(=O)c2c(O)cc(O)c(C3CCNCC3O)c2o1 |
| InChI | InChI=1S/C21H24ClNO5/c1-3-4-5-12(11(2)22)18-9-16(26)20-15(25)8-14(24)19(21(20)28-18)13-6-7-23-10-17(13)27/h4-5,8-9,13,17,23-25,27H,3,6-7,10H2,1-2H3/b5-4-,12-11- |
| InChIKey | BWQYIZBOVSWIOF-NHTRZOJKSA-N |
| XLogP | 3.58 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|