C13H22ClFN2 — CID 142220885
N'-[(2E)-4-chloro-2-fluoropenta-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine;prop-1-yne (PubChem CID 142220885) has the molecular formula C13H22ClFN2 and a molecular weight of 260.78 g/mol. Its IUPAC name is N'-[(2E)-4-chloro-2-fluoropenta-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine;prop-1-yne.
| Compound Name | N'-[(2E)-4-chloro-2-fluoropenta-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine;prop-1-yne |
|---|---|
| PubChem CID | 142220885 |
| Molecular Formula | C13H22ClFN2 |
| Molecular Weight | 260.78 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N'-[(2E)-4-chloro-2-fluoropenta-2,4-dienyl]-N,N,N'-trimethylethane-1,2-diamine;prop-1-yne |
| SMILES | C#CC.C=C(Cl)/C=C(/F)CN(C)CCN(C)C |
| InChI | InChI=1S/C10H18ClFN2.C3H4/c1-9(11)7-10(12)8-14(4)6-5-13(2)3;1-3-2/h7H,1,5-6,8H2,2-4H3;1H,2H3/b10-7+; |
| InChIKey | VEDFQKGHOMJIFI-HCUGZAAXSA-N |
| XLogP | 2.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|