About (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde
(1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde (PubChem CID 142220931) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde.
Molecular Properties
| Compound Name | (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde |
| PubChem CID | 142220931 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde |
| SMILES | C=C/C=C\OC.CC/C=C1/C=CC=CN1CC=O |
| InChI | InChI=1S/C10H13NO.C5H8O/c1-2-5-10-6-3-4-7-11(10)8-9-12;1-3-4-5-6-2/h3-7,9H,2,8H2,1H3;3-5H,1H2,2H3/b10-5-;5-4- |
| InChIKey | VGXVVRUROGQFRR-HYGJUWNWSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde?
The IUPAC name of (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde (CID 142220931) is (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde.
What is the SMILES notation for (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde?
The canonical SMILES for (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde is C=C/C=C\OC.CC/C=C1/C=CC=CN1CC=O.
What is the InChIKey of (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde?
The InChIKey is VGXVVRUROGQFRR-HYGJUWNWSA-N. The full InChI is InChI=1S/C10H13NO.C5H8O/c1-2-5-10-6-3-4-7-11(10)8-9-12;1-3-4-5-6-2/h3-7,9H,2,8H2,1H3;3-5H,1H2,2H3/b10-5-;5-4-.
What are the key properties of (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde?
(1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde has a molecular weight of 247.34 g/mol, XLogP of 3.20, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-methoxybuta-1,3-diene;2-[(2Z)-2-propylidene-1-pyridinyl]acetaldehyde is sourced from PubChem (CID 142220931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).