C10H13N — CID 142220946
N-[(3E,5Z)-4-ethenylhepta-1,3,5-trien-3-yl]methanimine (PubChem CID 142220946) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is N-[(3E,5Z)-4-ethenylhepta-1,3,5-trien-3-yl]methanimine.
| Compound Name | N-[(3E,5Z)-4-ethenylhepta-1,3,5-trien-3-yl]methanimine |
|---|---|
| PubChem CID | 142220946 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N-[(3E,5Z)-4-ethenylhepta-1,3,5-trien-3-yl]methanimine |
| SMILES | C=CC(/C=C\C)=C(/C=C)N=C |
| InChI | InChI=1S/C10H13N/c1-5-8-9(6-2)10(7-3)11-4/h5-8H,2-4H2,1H3/b8-5-,10-9+ |
| InChIKey | CGNSOWACOZMTLC-RGPKZFNQSA-N |
| XLogP | 2.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|