About ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane
ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane (PubChem CID 142221831) has the molecular formula C13H30OS
and a molecular weight of 234.45 g/mol. Its IUPAC name is ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane.
Molecular Properties
| Compound Name | ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane |
| PubChem CID | 142221831 |
| Molecular Formula | C13H30OS |
| Molecular Weight | 234.45 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane |
| SMILES | CC.CC.CCC1CSC(C)(C(C)C)O1 |
| InChI | InChI=1S/C9H18OS.2C2H6/c1-5-8-6-11-9(4,10-8)7(2)3;2*1-2/h7-8H,5-6H2,1-4H3;2*1-2H3 |
| InChIKey | AYLKLOYBBHFYDJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane?
The IUPAC name of ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane (CID 142221831) is ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane.
What is the SMILES notation for ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane?
The canonical SMILES for ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane is CC.CC.CCC1CSC(C)(C(C)C)O1.
What is the InChIKey of ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane?
The InChIKey is AYLKLOYBBHFYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18OS.2C2H6/c1-5-8-6-11-9(4,10-8)7(2)3;2*1-2/h7-8H,5-6H2,1-4H3;2*1-2H3.
What are the key properties of ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane?
ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane has a molecular weight of 234.45 g/mol, XLogP of 4.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-2-methyl-2-propan-2-yl-1,3-oxathiolane is sourced from PubChem (CID 142221831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).