C18H33N3S — CID 142221918
N-[2-(ethenylamino)ethylsulfanyl]-1-methylpiperidin-4-amine;(3Z)-3-ethylhexa-1,3,5-triene (PubChem CID 142221918) has the molecular formula C18H33N3S and a molecular weight of 323.55 g/mol. Its IUPAC name is N-[2-(ethenylamino)ethylsulfanyl]-1-methylpiperidin-4-amine;(3Z)-3-ethylhexa-1,3,5-triene.
| Compound Name | N-[2-(ethenylamino)ethylsulfanyl]-1-methylpiperidin-4-amine;(3Z)-3-ethylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 142221918 |
| Molecular Formula | C18H33N3S |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | N-[2-(ethenylamino)ethylsulfanyl]-1-methylpiperidin-4-amine;(3Z)-3-ethylhexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C)CC.C=CNCCSNC1CCN(C)CC1 |
| InChI | InChI=1S/C10H21N3S.C8H12/c1-3-11-6-9-14-12-10-4-7-13(2)8-5-10;1-4-7-8(5-2)6-3/h3,10-12H,1,4-9H2,2H3;4-5,7H,1-2,6H2,3H3/b;8-7+ |
| InChIKey | APERGJQSNSRBPP-ILHSMLOTSA-N |
| XLogP | 3.75 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|