About ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine
ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine (PubChem CID 142222860) has the molecular formula C10H14F3N3
and a molecular weight of 233.24 g/mol. Its IUPAC name is ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine |
| PubChem CID | 142222860 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine |
| SMILES | CC.Cn1c(C(F)(F)F)nc2c1C=CCN2 |
| InChI | InChI=1S/C8H8F3N3.C2H6/c1-14-5-3-2-4-12-6(5)13-7(14)8(9,10)11;1-2/h2-3,12H,4H2,1H3;1-2H3 |
| InChIKey | HRCVVXJLDZZYAU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine?
The IUPAC name of ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine (CID 142222860) is ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine.
What is the SMILES notation for ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine?
The canonical SMILES for ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine is CC.Cn1c(C(F)(F)F)nc2c1C=CCN2.
What is the InChIKey of ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine?
The InChIKey is HRCVVXJLDZZYAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3.C2H6/c1-14-5-3-2-4-12-6(5)13-7(14)8(9,10)11;1-2/h2-3,12H,4H2,1H3;1-2H3.
What are the key properties of ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine?
ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine has a molecular weight of 233.24 g/mol, XLogP of 2.90, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-2-(trifluoromethyl)-4,5-dihydroimidazo[4,5-b]pyridine is sourced from PubChem (CID 142222860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).