About 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene
3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene (PubChem CID 142223557) has the molecular formula C26H33N3O
and a molecular weight of 403.57 g/mol. Its IUPAC name is 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene.
Molecular Properties
| Compound Name | 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene |
| PubChem CID | 142223557 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene |
| SMILES | CCCC(C)/N=C(\N)c1cccc(NCc2ccc(O)cc2)c1.Cc1ccccc1 |
| InChI | InChI=1S/C19H25N3O.C7H8/c1-3-5-14(2)22-19(20)16-6-4-7-17(12-16)21-13-15-8-10-18(23)11-9-15;1-7-5-3-2-4-6-7/h4,6-12,14,21,23H,3,5,13H2,1-2H3,(H2,20,22);2-6H,1H3 |
| InChIKey | TVJBFXQAFZYYRU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene?
The IUPAC name of 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene (CID 142223557) is 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene.
What is the SMILES notation for 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene?
The canonical SMILES for 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene is CCCC(C)/N=C(\N)c1cccc(NCc2ccc(O)cc2)c1.Cc1ccccc1.
What is the InChIKey of 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene?
The InChIKey is TVJBFXQAFZYYRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O.C7H8/c1-3-5-14(2)22-19(20)16-6-4-7-17(12-16)21-13-15-8-10-18(23)11-9-15;1-7-5-3-2-4-6-7/h4,6-12,14,21,23H,3,5,13H2,1-2H3,(H2,20,22);2-6H,1H3.
What are the key properties of 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene?
3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene has a molecular weight of 403.57 g/mol, XLogP of 5.89, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-hydroxyphenyl)methylamino]-N'-pentan-2-ylbenzenecarboximidamide;toluene is sourced from PubChem (CID 142223557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).