About ethane;4-methyl-2,5-dihydropyrazin-3-one
ethane;4-methyl-2,5-dihydropyrazin-3-one (PubChem CID 142224271) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is ethane;4-methyl-2,5-dihydropyrazin-3-one.
Molecular Properties
| Compound Name | ethane;4-methyl-2,5-dihydropyrazin-3-one |
| PubChem CID | 142224271 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | ethane;4-methyl-2,5-dihydropyrazin-3-one |
| SMILES | CC.CC.CN1CC=NCC1=O |
| InChI | InChI=1S/C5H8N2O.2C2H6/c1-7-3-2-6-4-5(7)8;2*1-2/h2H,3-4H2,1H3;2*1-2H3 |
| InChIKey | ACYUZBFMPUQHKF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-methyl-2,5-dihydropyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-2,5-dihydropyrazin-3-one?
The IUPAC name of ethane;4-methyl-2,5-dihydropyrazin-3-one (CID 142224271) is ethane;4-methyl-2,5-dihydropyrazin-3-one.
What is the SMILES notation for ethane;4-methyl-2,5-dihydropyrazin-3-one?
The canonical SMILES for ethane;4-methyl-2,5-dihydropyrazin-3-one is CC.CC.CN1CC=NCC1=O.
What is the InChIKey of ethane;4-methyl-2,5-dihydropyrazin-3-one?
The InChIKey is ACYUZBFMPUQHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O.2C2H6/c1-7-3-2-6-4-5(7)8;2*1-2/h2H,3-4H2,1H3;2*1-2H3.
What are the key properties of ethane;4-methyl-2,5-dihydropyrazin-3-one?
ethane;4-methyl-2,5-dihydropyrazin-3-one has a molecular weight of 172.27 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-2,5-dihydropyrazin-3-one is sourced from PubChem (CID 142224271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).