About ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane
ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane (PubChem CID 142224390) has the molecular formula C11H19N3S
and a molecular weight of 225.36 g/mol. Its IUPAC name is ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane.
Molecular Properties
| Compound Name | ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane |
| PubChem CID | 142224390 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane |
| SMILES | CC.Cc1ccc(N2CCCNS2)cn1 |
| InChI | InChI=1S/C9H13N3S.C2H6/c1-8-3-4-9(7-10-8)12-6-2-5-11-13-12;1-2/h3-4,7,11H,2,5-6H2,1H3;1-2H3 |
| InChIKey | OKXUJSRWBHVBAR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane?
The IUPAC name of ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane (CID 142224390) is ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane.
What is the SMILES notation for ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane?
The canonical SMILES for ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane is CC.Cc1ccc(N2CCCNS2)cn1.
What is the InChIKey of ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane?
The InChIKey is OKXUJSRWBHVBAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3S.C2H6/c1-8-3-4-9(7-10-8)12-6-2-5-11-13-12;1-2/h3-4,7,11H,2,5-6H2,1H3;1-2H3.
What are the key properties of ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane?
ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane has a molecular weight of 225.36 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(6-methyl-3-pyridinyl)-1,2,6-thiadiazinane is sourced from PubChem (CID 142224390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).