About (3Z)-5-methylhepta-1,3-dien-6-yne
(3Z)-5-methylhepta-1,3-dien-6-yne (PubChem CID 142224471) has the molecular formula C8H10
and a molecular weight of 106.17 g/mol. Its IUPAC name is (3Z)-5-methylhepta-1,3-dien-6-yne.
Molecular Properties
| Compound Name | (3Z)-5-methylhepta-1,3-dien-6-yne |
| PubChem CID | 142224471 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | (3Z)-5-methylhepta-1,3-dien-6-yne |
| SMILES | C#CC(C)/C=C\C=C |
| InChI | InChI=1S/C8H10/c1-4-6-7-8(3)5-2/h2,4,6-8H,1H2,3H3/b7-6- |
| InChIKey | NHWNLELVZYNRNX-SREVYHEPSA-N |
| XLogP | 2.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-methylhepta-1,3-dien-6-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-methylhepta-1,3-dien-6-yne?
The IUPAC name of (3Z)-5-methylhepta-1,3-dien-6-yne (CID 142224471) is (3Z)-5-methylhepta-1,3-dien-6-yne.
What is the SMILES notation for (3Z)-5-methylhepta-1,3-dien-6-yne?
The canonical SMILES for (3Z)-5-methylhepta-1,3-dien-6-yne is C#CC(C)/C=C\C=C.
What is the InChIKey of (3Z)-5-methylhepta-1,3-dien-6-yne?
The InChIKey is NHWNLELVZYNRNX-SREVYHEPSA-N. The full InChI is InChI=1S/C8H10/c1-4-6-7-8(3)5-2/h2,4,6-8H,1H2,3H3/b7-6-.
What are the key properties of (3Z)-5-methylhepta-1,3-dien-6-yne?
(3Z)-5-methylhepta-1,3-dien-6-yne has a molecular weight of 106.17 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-methylhepta-1,3-dien-6-yne is sourced from PubChem (CID 142224471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).